C15H19FN2O4 — CID 146133334
2-[(4-fluoro-3-morpholin-4-ylphenyl)carbamoyl]butanoic acid (PubChem CID 146133334) has the molecular formula C15H19FN2O4 and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-[(4-fluoro-3-morpholin-4-ylphenyl)carbamoyl]butanoic acid.
| Compound Name | 2-[(4-fluoro-3-morpholin-4-ylphenyl)carbamoyl]butanoic acid |
|---|---|
| PubChem CID | 146133334 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[(4-fluoro-3-morpholin-4-ylphenyl)carbamoyl]butanoic acid |
| SMILES | CCC(C(=O)O)C(=O)Nc1ccc(F)c(N2CCOCC2)c1 |
| InChI | InChI=1S/C15H19FN2O4/c1-2-11(15(20)21)14(19)17-10-3-4-12(16)13(9-10)18-5-7-22-8-6-18/h3-4,9,11H,2,5-8H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | RSHDCPXOTOCYTN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|