C15H19N3O4 — CID 146135984
2-[(6-methoxy-1H-indazol-3-yl)carbamoyl]-3,3-dimethylbutanoic acid (PubChem CID 146135984) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[(6-methoxy-1H-indazol-3-yl)carbamoyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(6-methoxy-1H-indazol-3-yl)carbamoyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 146135984 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[(6-methoxy-1H-indazol-3-yl)carbamoyl]-3,3-dimethylbutanoic acid |
| SMILES | COc1ccc2c(NC(=O)C(C(=O)O)C(C)(C)C)n[nH]c2c1 |
| InChI | InChI=1S/C15H19N3O4/c1-15(2,3)11(14(20)21)13(19)16-12-9-6-5-8(22-4)7-10(9)17-18-12/h5-7,11H,1-4H3,(H,20,21)(H2,16,17,18,19) |
| InChIKey | JOWIMPLPURSXKP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|