C13H12F2N2O5S — CID 146136041
3-[[4-(difluoromethoxy)-1,3-benzothiazol-2-yl]amino]-2-methoxy-2-methyl-3-oxopropanoic acid (PubChem CID 146136041) has the molecular formula C13H12F2N2O5S and a molecular weight of 346.31 g/mol. Its IUPAC name is 3-[[4-(difluoromethoxy)-1,3-benzothiazol-2-yl]amino]-2-methoxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[[4-(difluoromethoxy)-1,3-benzothiazol-2-yl]amino]-2-methoxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 146136041 |
| Molecular Formula | C13H12F2N2O5S |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 3-[[4-(difluoromethoxy)-1,3-benzothiazol-2-yl]amino]-2-methoxy-2-methyl-3-oxopropanoic acid |
| SMILES | COC(C)(C(=O)O)C(=O)Nc1nc2c(OC(F)F)cccc2s1 |
| InChI | InChI=1S/C13H12F2N2O5S/c1-13(21-2,10(19)20)9(18)17-12-16-8-6(22-11(14)15)4-3-5-7(8)23-12/h3-5,11H,1-2H3,(H,19,20)(H,16,17,18) |
| InChIKey | IJGPLPPSDZOZNC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|