C17H12Cl4NNaO3 — CID 146146594
sodium 4-(3,5-dichloroanilino)-2-(3,4-dichlorophenyl)-2-methyl-4-oxobutanoate (PubChem CID 146146594) has the molecular formula C17H12Cl4NNaO3 and a molecular weight of 443.09 g/mol. Its IUPAC name is sodium 4-(3,5-dichloroanilino)-2-(3,4-dichlorophenyl)-2-methyl-4-oxobutanoate.
| Compound Name | sodium 4-(3,5-dichloroanilino)-2-(3,4-dichlorophenyl)-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 146146594 |
| Molecular Formula | C17H12Cl4NNaO3 |
| Molecular Weight | 443.09 g/mol |
| Exact Mass | 440.95 |
| IUPAC Name | sodium 4-(3,5-dichloroanilino)-2-(3,4-dichlorophenyl)-2-methyl-4-oxobutanoate |
| SMILES | CC(CC(=O)Nc1cc(Cl)cc(Cl)c1)(C(=O)[O-])c1ccc(Cl)c(Cl)c1.[Na+] |
| InChI | InChI=1S/C17H13Cl4NO3.Na/c1-17(16(24)25,9-2-3-13(20)14(21)4-9)8-15(23)22-12-6-10(18)5-11(19)7-12;/h2-7H,8H2,1H3,(H,22,23)(H,24,25);/q;+1/p-1 |
| InChIKey | UUIYTSSOJWRFQE-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.09 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |