C20H13Cl2NO4 — CID 146147813
3-chloro-N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 146147813) has the molecular formula C20H13Cl2NO4 and a molecular weight of 402.23 g/mol. Its IUPAC name is 3-chloro-N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-chloro-N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 146147813 |
| Molecular Formula | C20H13Cl2NO4 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 3-chloro-N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2ccc(CO)o2)c1)c1oc2ccccc2c1Cl |
| InChI | InChI=1S/C20H13Cl2NO4/c21-15-7-5-11(9-14(15)17-8-6-12(10-24)26-17)23-20(25)19-18(22)13-3-1-2-4-16(13)27-19/h1-9,24H,10H2,(H,23,25) |
| InChIKey | GJSDPRSYMMNEDT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |