C11H8Cl2N2O3S2 — CID 146154175
3-(3,4-dichlorophenyl)-N-methylsulfonyl-1,2-thiazole-5-carboxamide (PubChem CID 146154175) has the molecular formula C11H8Cl2N2O3S2 and a molecular weight of 351.24 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-methylsulfonyl-1,2-thiazole-5-carboxamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-methylsulfonyl-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 146154175 |
| Molecular Formula | C11H8Cl2N2O3S2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-methylsulfonyl-1,2-thiazole-5-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(-c2ccc(Cl)c(Cl)c2)ns1 |
| InChI | InChI=1S/C11H8Cl2N2O3S2/c1-20(17,18)15-11(16)10-5-9(14-19-10)6-2-3-7(12)8(13)4-6/h2-5H,1H3,(H,15,16) |
| InChIKey | SXQAKATXEVGFTE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |