C22H27N7O8 — CID 146157037
tert-butyl 3,4-diacetyloxy-2-(acetyloxymethyl)-5-(4-azido-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate (PubChem CID 146157037) has the molecular formula C22H27N7O8 and a molecular weight of 517.50 g/mol. Its IUPAC name is tert-butyl 3,4-diacetyloxy-2-(acetyloxymethyl)-5-(4-azido-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3,4-diacetyloxy-2-(acetyloxymethyl)-5-(4-azido-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146157037 |
| Molecular Formula | C22H27N7O8 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | tert-butyl 3,4-diacetyloxy-2-(acetyloxymethyl)-5-(4-azido-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)OCC1C(OC(C)=O)C(OC(C)=O)C(c2c[nH]c3c(N=[N+]=[N-])ncnc23)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27N7O8/c1-10(30)34-8-14-18(35-11(2)31)19(36-12(3)32)17(29(14)21(33)37-22(4,5)6)13-7-24-16-15(13)25-9-26-20(16)27-28-23/h7,9,14,17-19,24H,8H2,1-6H3 |
| InChIKey | TWDCEVCHMWHXIX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 198.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|