C18H18Cl3N5O10 — CID 11017247
2,2,2-trichloroethyl (2R,3R,4S,5S)-3,4-diacetyloxy-2-(acetyloxymethyl)-5-(3-cyano-4-nitro-1H-pyrazol-5-yl)pyrrolidine-1-carboxylate (PubChem CID 11017247) has the molecular formula C18H18Cl3N5O10 and a molecular weight of 570.73 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2R,3R,4S,5S)-3,4-diacetyloxy-2-(acetyloxymethyl)-5-(3-cyano-4-nitro-1H-pyrazol-5-yl)pyrrolidine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (2R,3R,4S,5S)-3,4-diacetyloxy-2-(acetyloxymethyl)-5-(3-cyano-4-nitro-1H-pyrazol-5-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11017247 |
| Molecular Formula | C18H18Cl3N5O10 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 569.01 |
| IUPAC Name | 2,2,2-trichloroethyl (2R,3R,4S,5S)-3,4-diacetyloxy-2-(acetyloxymethyl)-5-(3-cyano-4-nitro-1H-pyrazol-5-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)OC[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](c2[nH]nc(C#N)c2[N+](=O)[O-])N1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H18Cl3N5O10/c1-7(27)33-5-11-15(35-8(2)28)16(36-9(3)29)14(25(11)17(30)34-6-18(19,20)21)12-13(26(31)32)10(4-22)23-24-12/h11,14-16H,5-6H2,1-3H3,(H,23,24)/t11-,14+,15-,16+/m1/s1 |
| InChIKey | GKNZSFMVYHTVLD-CAPXZKIUSA-N |
| XLogP | 1.85 |
| TPSA | 204.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|