C32H30FN3O4 — CID 146157483
2-[[5-fluoro-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]oxy]pyrimidin-4-amine (PubChem CID 146157483) has the molecular formula C32H30FN3O4 and a molecular weight of 539.61 g/mol. Its IUPAC name is 2-[[5-fluoro-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]oxy]pyrimidin-4-amine.
| Compound Name | 2-[[5-fluoro-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]oxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146157483 |
| Molecular Formula | C32H30FN3O4 |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 2-[[5-fluoro-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]oxy]pyrimidin-4-amine |
| SMILES | CC1(C)OC2C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)=C(F)C(Oc3nccc(N)n3)C2O1 |
| InChI | InChI=1S/C32H30FN3O4/c1-31(2)39-27-24(26(33)28(29(27)40-31)38-30-35-19-18-25(34)36-30)20-37-32(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-19,27-29H,20H2,1-2H3,(H2,34,35,36) |
| InChIKey | LOUGDQSDLDRXID-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|