C39H33FN2O6 — CID 91030452
3-benzoyl-1-[5-fluoro-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione (PubChem CID 91030452) has the molecular formula C39H33FN2O6 and a molecular weight of 644.70 g/mol. Its IUPAC name is 3-benzoyl-1-[5-fluoro-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[5-fluoro-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91030452 |
| Molecular Formula | C39H33FN2O6 |
| Molecular Weight | 644.70 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | 3-benzoyl-1-[5-fluoro-2,2-dimethyl-4-(trityloxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione |
| SMILES | CC1(C)OC2C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)=C(F)C(n3ccc(=O)n(C(=O)c4ccccc4)c3=O)C2O1 |
| InChI | InChI=1S/C39H33FN2O6/c1-38(2)47-34-30(25-46-39(27-17-9-4-10-18-27,28-19-11-5-12-20-28)29-21-13-6-14-22-29)32(40)33(35(34)48-38)41-24-23-31(43)42(37(41)45)36(44)26-15-7-3-8-16-26/h3-24,33-35H,25H2,1-2H3 |
| InChIKey | BWAOZCKHJJFUAH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.70 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|