C19H32O4Si — CID 146166022
(1S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethoxytricyclo[5.2.2.01,5]undec-10-en-9-one (PubChem CID 146166022) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is (1S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethoxytricyclo[5.2.2.01,5]undec-10-en-9-one.
| Compound Name | (1S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethoxytricyclo[5.2.2.01,5]undec-10-en-9-one |
|---|---|
| PubChem CID | 146166022 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (1S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethoxytricyclo[5.2.2.01,5]undec-10-en-9-one |
| SMILES | COC1(OC)C(=O)[C@]23C=CC1C[C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)C3 |
| InChI | InChI=1S/C19H32O4Si/c1-17(2,3)24(6,7)23-15-11-14-10-13-8-9-18(14,12-15)16(20)19(13,21-4)22-5/h8-9,13-15H,10-12H2,1-7H3/t13?,14-,15+,18-/m0/s1 |
| InChIKey | QSCPTPSRAOEWHN-MUSFGAPCSA-N |
| XLogP | 3.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|