C17H21N3O7 — CID 146167501
(2,3-dimethyl-1-morpholin-4-ylbut-3-en-2-yl) 3,5-dinitrobenzoate (PubChem CID 146167501) has the molecular formula C17H21N3O7 and a molecular weight of 379.37 g/mol. Its IUPAC name is (2,3-dimethyl-1-morpholin-4-ylbut-3-en-2-yl) 3,5-dinitrobenzoate.
| Compound Name | (2,3-dimethyl-1-morpholin-4-ylbut-3-en-2-yl) 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 146167501 |
| Molecular Formula | C17H21N3O7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (2,3-dimethyl-1-morpholin-4-ylbut-3-en-2-yl) 3,5-dinitrobenzoate |
| SMILES | C=C(C)C(C)(CN1CCOCC1)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H21N3O7/c1-12(2)17(3,11-18-4-6-26-7-5-18)27-16(21)13-8-14(19(22)23)10-15(9-13)20(24)25/h8-10H,1,4-7,11H2,2-3H3 |
| InChIKey | SCVNUPKUMGICFY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|