C23H32N6O2 — CID 146171807
6-[(3R)-1-methoxyhexan-3-yl]oxy-1-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 146171807) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 6-[(3R)-1-methoxyhexan-3-yl]oxy-1-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-[(3R)-1-methoxyhexan-3-yl]oxy-1-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146171807 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 6-[(3R)-1-methoxyhexan-3-yl]oxy-1-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCC[C@H](CCOC)Oc1nc(N)c2cnn(Cc3ccc(N4CCCC4)cc3)c2n1 |
| InChI | InChI=1S/C23H32N6O2/c1-3-6-19(11-14-30-2)31-23-26-21(24)20-15-25-29(22(20)27-23)16-17-7-9-18(10-8-17)28-12-4-5-13-28/h7-10,15,19H,3-6,11-14,16H2,1-2H3,(H2,24,26,27)/t19-/m1/s1 |
| InChIKey | RSGCNRUNHSFLKT-LJQANCHMSA-N |
| XLogP | 3.64 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|