C14H13N3O5 — CID 146171932
(2S)-2,7-dimethyl-10-nitro-2,3-dihydro-1H-[1,4]oxazepino[6,5-c]quinoline-5,6-dione (PubChem CID 146171932) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is (2S)-2,7-dimethyl-10-nitro-2,3-dihydro-1H-[1,4]oxazepino[6,5-c]quinoline-5,6-dione.
| Compound Name | (2S)-2,7-dimethyl-10-nitro-2,3-dihydro-1H-[1,4]oxazepino[6,5-c]quinoline-5,6-dione |
|---|---|
| PubChem CID | 146171932 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (2S)-2,7-dimethyl-10-nitro-2,3-dihydro-1H-[1,4]oxazepino[6,5-c]quinoline-5,6-dione |
| SMILES | C[C@H]1COC(=O)c2c(c3cc([N+](=O)[O-])ccc3n(C)c2=O)N1 |
| InChI | InChI=1S/C14H13N3O5/c1-7-6-22-14(19)11-12(15-7)9-5-8(17(20)21)3-4-10(9)16(2)13(11)18/h3-5,7,15H,6H2,1-2H3/t7-/m0/s1 |
| InChIKey | VAMXXICALJWRBH-ZETCQYMHSA-N |
| XLogP | 1.42 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|