C22H31N7O — CID 146174212
6-(pyridin-4-ylmethoxy)-1-(7-pyrrolidin-1-ylheptyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 146174212) has the molecular formula C22H31N7O and a molecular weight of 409.54 g/mol. Its IUPAC name is 6-(pyridin-4-ylmethoxy)-1-(7-pyrrolidin-1-ylheptyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-(pyridin-4-ylmethoxy)-1-(7-pyrrolidin-1-ylheptyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146174212 |
| Molecular Formula | C22H31N7O |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 6-(pyridin-4-ylmethoxy)-1-(7-pyrrolidin-1-ylheptyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(OCc2ccncc2)nc2c1cnn2CCCCCCCN1CCCC1 |
| InChI | InChI=1S/C22H31N7O/c23-20-19-16-25-29(15-5-3-1-2-4-12-28-13-6-7-14-28)21(19)27-22(26-20)30-17-18-8-10-24-11-9-18/h8-11,16H,1-7,12-15,17H2,(H2,23,26,27) |
| InChIKey | UUEVKMTVNVCWRQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|