C13H17N2O3S- — CID 146174757
(2E,3Z,5R)-5-acetamido-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate (PubChem CID 146174757) has the molecular formula C13H17N2O3S- and a molecular weight of 281.36 g/mol. Its IUPAC name is (2E,3Z,5R)-5-acetamido-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate.
| Compound Name | (2E,3Z,5R)-5-acetamido-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate |
|---|---|
| PubChem CID | 146174757 |
| Molecular Formula | C13H17N2O3S- |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (2E,3Z,5R)-5-acetamido-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate |
| SMILES | C=C/C=C1/C[C@@H](NC(C)=O)CN(S(=O)[O-])/C1=C/C=C |
| InChI | InChI=1S/C13H18N2O3S/c1-4-6-11-8-12(14-10(3)16)9-15(19(17)18)13(11)7-5-2/h4-7,12H,1-2,8-9H2,3H3,(H,14,16)(H,17,18)/p-1/b11-6-,13-7+/t12-/m1/s1 |
| InChIKey | VINOSZMOVBLLPH-BAKHCGKDSA-M |
| XLogP | 1.17 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|