C30H50O — CID 146180812
(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-[(E,3S,6R)-3,6,7-trimethyloct-4-enyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 146180812) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-[(E,3S,6R)-3,6,7-trimethyloct-4-enyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-[(E,3S,6R)-3,6,7-trimethyloct-4-enyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 146180812 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-[(E,3S,6R)-3,6,7-trimethyloct-4-enyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)[C@@H](C)/C=C/[C@@H](C)CC[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H50O/c1-20(2)22(4)9-7-21(3)8-10-23-12-14-27-26-13-11-24-19-25(31)15-17-30(24,6)28(26)16-18-29(23,27)5/h7,9,11,20-23,25-28,31H,8,10,12-19H2,1-6H3/b9-7+/t21-,22+,23+,25+,26+,27+,28+,29-,30+/m1/s1 |
| InChIKey | HHGHOMHJNZSUDO-YXPRTYFLSA-N |
| XLogP | 8.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|