C23H21ClFN3O5 — CID 146182489
(4R)-N-[(3-chloro-2-fluorophenyl)methyl]-11-hydroxy-9,12-dioxo-3-oxa-8,17-diazapentacyclo[8.6.1.14,7.02,8.014,17]octadeca-10,13-diene-13-carboxamide (PubChem CID 146182489) has the molecular formula C23H21ClFN3O5 and a molecular weight of 473.89 g/mol. Its IUPAC name is (4R)-N-[(3-chloro-2-fluorophenyl)methyl]-11-hydroxy-9,12-dioxo-3-oxa-8,17-diazapentacyclo[8.6.1.14,7.02,8.014,17]octadeca-10,13-diene-13-carboxamide.
| Compound Name | (4R)-N-[(3-chloro-2-fluorophenyl)methyl]-11-hydroxy-9,12-dioxo-3-oxa-8,17-diazapentacyclo[8.6.1.14,7.02,8.014,17]octadeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 146182489 |
| Molecular Formula | C23H21ClFN3O5 |
| Molecular Weight | 473.89 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | (4R)-N-[(3-chloro-2-fluorophenyl)methyl]-11-hydroxy-9,12-dioxo-3-oxa-8,17-diazapentacyclo[8.6.1.14,7.02,8.014,17]octadeca-10,13-diene-13-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1F)c1c2n3c(c(O)c1=O)C(=O)N1C4CC[C@H](C4)OC1C3CC2 |
| InChI | InChI=1S/C23H21ClFN3O5/c24-13-3-1-2-10(17(13)25)9-26-21(31)16-14-6-7-15-23-27(11-4-5-12(8-11)33-23)22(32)18(28(14)15)20(30)19(16)29/h1-3,11-12,15,23,30H,4-9H2,(H,26,31)/t11?,12-,15?,23?/m1/s1 |
| InChIKey | GWJLHUWZUNKGRG-GBNUWYNTSA-N |
| XLogP | 2.50 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.89 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |