C30H33ClF4N4O10 — CID 175758543
[(1R,2S)-12-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-dien-10-yl]oxymethyl 3-(dimethylamino)propyl carbonate;2,2,2-trifluoroacetic acid (PubChem CID 175758543) has the molecular formula C30H33ClF4N4O10 and a molecular weight of 721.06 g/mol. Its IUPAC name is [(1R,2S)-12-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-dien-10-yl]oxymethyl 3-(dimethylamino)propyl carbonate;2,2,2-trifluoroacetic acid.
| Compound Name | [(1R,2S)-12-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-dien-10-yl]oxymethyl 3-(dimethylamino)propyl carbonate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175758543 |
| Molecular Formula | C30H33ClF4N4O10 |
| Molecular Weight | 721.06 g/mol |
| Exact Mass | 720.18 |
| IUPAC Name | [(1R,2S)-12-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-dien-10-yl]oxymethyl 3-(dimethylamino)propyl carbonate;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCCOC(=O)OCOc1c2n3c(c(C(=O)NCc4cccc(Cl)c4F)c1=O)CC[C@@H]3[C@@H]1OCCCN1C2=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H32ClFN4O8.C2HF3O2/c1-32(2)10-4-13-40-28(38)42-15-41-24-22-26(37)33-11-5-12-39-27(33)19-9-8-18(34(19)22)20(23(24)35)25(36)31-14-16-6-3-7-17(29)21(16)30;3-2(4,5)1(6)7/h3,6-7,19,27H,4-5,8-15H2,1-2H3,(H,31,36);(H,6,7)/t19-,27+;/m1./s1 |
| InChIKey | VQLXVMKUKKQOCN-ZLRSFIRASA-N |
| XLogP | 3.33 |
| TPSA | 165.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.06 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|