C21H21ClFN3O5 — CID 155468381
(1R,2S)-N-[(3-chloro-2-fluorophenyl)methyl]-10,11-dihydroxy-8-oxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide (PubChem CID 155468381) has the molecular formula C21H21ClFN3O5 and a molecular weight of 449.87 g/mol. Its IUPAC name is (1R,2S)-N-[(3-chloro-2-fluorophenyl)methyl]-10,11-dihydroxy-8-oxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide.
| Compound Name | (1R,2S)-N-[(3-chloro-2-fluorophenyl)methyl]-10,11-dihydroxy-8-oxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 155468381 |
| Molecular Formula | C21H21ClFN3O5 |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (1R,2S)-N-[(3-chloro-2-fluorophenyl)methyl]-10,11-dihydroxy-8-oxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1F)C1=C2CC[C@@H]3[C@@H]4OCCCN4C(=O)C(=C(O)C1O)N23 |
| InChI | InChI=1S/C21H21ClFN3O5/c22-11-4-1-3-10(15(11)23)9-24-19(29)14-12-5-6-13-21-25(7-2-8-31-21)20(30)16(26(12)13)18(28)17(14)27/h1,3-4,13,17,21,27-28H,2,5-9H2,(H,24,29)/t13-,17?,21+/m1/s1 |
| InChIKey | DTMCXRVBOJVFRU-KVCBOLPTSA-N |
| XLogP | 1.55 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |