C22H21ClFN3O5 — CID 174224725
(1R,2S)-N-[(3-chloro-2-fluorophenyl)methyl]-10-methoxy-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide (PubChem CID 174224725) has the molecular formula C22H21ClFN3O5 and a molecular weight of 461.88 g/mol. Its IUPAC name is (1R,2S)-N-[(3-chloro-2-fluorophenyl)methyl]-10-methoxy-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide.
| Compound Name | (1R,2S)-N-[(3-chloro-2-fluorophenyl)methyl]-10-methoxy-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 174224725 |
| Molecular Formula | C22H21ClFN3O5 |
| Molecular Weight | 461.88 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | (1R,2S)-N-[(3-chloro-2-fluorophenyl)methyl]-10-methoxy-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide |
| SMILES | COc1c2n3c(c(C(=O)NCc4cccc(Cl)c4F)c1=O)CC[C@@H]3[C@@H]1OCCCN1C2=O |
| InChI | InChI=1S/C22H21ClFN3O5/c1-31-19-17-21(30)26-8-3-9-32-22(26)14-7-6-13(27(14)17)15(18(19)28)20(29)25-10-11-4-2-5-12(23)16(11)24/h2,4-5,14,22H,3,6-10H2,1H3,(H,25,29)/t14-,22+/m1/s1 |
| InChIKey | FBKZHXRHOKTKTD-PEBXRYMYSA-N |
| XLogP | 2.27 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.88 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |