C28H33Cl2FN4O8 — CID 169274913
[(1R,2S)-12-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-dien-10-yl]oxymethyl 3-(dimethylamino)propyl carbonate;hydrochloride (PubChem CID 169274913) has the molecular formula C28H33Cl2FN4O8 and a molecular weight of 643.50 g/mol. Its IUPAC name is [(1R,2S)-12-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-dien-10-yl]oxymethyl 3-(dimethylamino)propyl carbonate;hydrochloride.
| Compound Name | [(1R,2S)-12-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-dien-10-yl]oxymethyl 3-(dimethylamino)propyl carbonate;hydrochloride |
|---|---|
| PubChem CID | 169274913 |
| Molecular Formula | C28H33Cl2FN4O8 |
| Molecular Weight | 643.50 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | [(1R,2S)-12-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-8,11-dioxo-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-dien-10-yl]oxymethyl 3-(dimethylamino)propyl carbonate;hydrochloride |
| SMILES | CN(C)CCCOC(=O)OCOc1c2n3c(c(C(=O)NCc4cccc(Cl)c4F)c1=O)CC[C@@H]3[C@@H]1OCCCN1C2=O.Cl |
| InChI | InChI=1S/C28H32ClFN4O8.ClH/c1-32(2)10-4-13-40-28(38)42-15-41-24-22-26(37)33-11-5-12-39-27(33)19-9-8-18(34(19)22)20(23(24)35)25(36)31-14-16-6-3-7-17(29)21(16)30;/h3,6-7,19,27H,4-5,8-15H2,1-2H3,(H,31,36);1H/t19-,27+;/m1./s1 |
| InChIKey | QXEYWNUKIXKXDF-ZLRSFIRASA-N |
| XLogP | 3.12 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|