C13H22N2O — CID 146187107
(2E,4Z)-6-(2-pyrrolidin-1-ylethoxy)hepta-2,4,6-trien-3-amine (PubChem CID 146187107) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (2E,4Z)-6-(2-pyrrolidin-1-ylethoxy)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-6-(2-pyrrolidin-1-ylethoxy)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 146187107 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (2E,4Z)-6-(2-pyrrolidin-1-ylethoxy)hepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C=C\C(N)=C/C)OCCN1CCCC1 |
| InChI | InChI=1S/C13H22N2O/c1-3-13(14)7-6-12(2)16-11-10-15-8-4-5-9-15/h3,6-7H,2,4-5,8-11,14H2,1H3/b7-6-,13-3+ |
| InChIKey | WJIOEVQQBSLXBI-YZWNIHMXSA-N |
| XLogP | 2.03 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|