C11H19N2O+ — CID 123967918
2-(1-ethoxyethenyl)-1,1,5-trimethylpyrrol-1-ium-3-amine (PubChem CID 123967918) has the molecular formula C11H19N2O+ and a molecular weight of 195.29 g/mol. Its IUPAC name is 2-(1-ethoxyethenyl)-1,1,5-trimethylpyrrol-1-ium-3-amine.
| Compound Name | 2-(1-ethoxyethenyl)-1,1,5-trimethylpyrrol-1-ium-3-amine |
|---|---|
| PubChem CID | 123967918 |
| Molecular Formula | C11H19N2O+ |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 2-(1-ethoxyethenyl)-1,1,5-trimethylpyrrol-1-ium-3-amine |
| SMILES | C=C(OCC)C1=C(N)C=C(C)[N+]1(C)C |
| InChI | InChI=1S/C11H19N2O/c1-6-14-9(3)11-10(12)7-8(2)13(11,4)5/h7H,3,6,12H2,1-2,4-5H3/q+1 |
| InChIKey | UYJZBXATPRGDKW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|