C13H19NO — CID 170005059
(3Z)-N-(2-buta-1,3-dien-2-yloxyethyl)-N-methylhexa-1,3,5-trien-2-amine (PubChem CID 170005059) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (3Z)-N-(2-buta-1,3-dien-2-yloxyethyl)-N-methylhexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-N-(2-buta-1,3-dien-2-yloxyethyl)-N-methylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 170005059 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (3Z)-N-(2-buta-1,3-dien-2-yloxyethyl)-N-methylhexa-1,3,5-trien-2-amine |
| SMILES | C=C/C=C\C(=C)N(C)CCOC(=C)C=C |
| InChI | InChI=1S/C13H19NO/c1-6-8-9-12(3)14(5)10-11-15-13(4)7-2/h6-9H,1-4,10-11H2,5H3/b9-8- |
| InChIKey | GEDGQIVLBRMUTA-HJWRWDBZSA-N |
| XLogP | 2.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|