C19H33N3O — CID 129236607
(3Z,5Z)-6-N-[(E)-3-methylpent-2-en-2-yl]-5-(2-pyrrolidin-1-ylethoxy)hepta-1,3,5-triene-2,6-diamine (PubChem CID 129236607) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is (3Z,5Z)-6-N-[(E)-3-methylpent-2-en-2-yl]-5-(2-pyrrolidin-1-ylethoxy)hepta-1,3,5-triene-2,6-diamine.
| Compound Name | (3Z,5Z)-6-N-[(E)-3-methylpent-2-en-2-yl]-5-(2-pyrrolidin-1-ylethoxy)hepta-1,3,5-triene-2,6-diamine |
|---|---|
| PubChem CID | 129236607 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | (3Z,5Z)-6-N-[(E)-3-methylpent-2-en-2-yl]-5-(2-pyrrolidin-1-ylethoxy)hepta-1,3,5-triene-2,6-diamine |
| SMILES | C=C(N)/C=C\C(OCCN1CCCC1)=C(/C)N/C(C)=C(\C)CC |
| InChI | InChI=1S/C19H33N3O/c1-6-15(2)17(4)21-18(5)19(10-9-16(3)20)23-14-13-22-11-7-8-12-22/h9-10,21H,3,6-8,11-14,20H2,1-2,4-5H3/b10-9-,17-15+,19-18- |
| InChIKey | PLAVQVBCYJAIOT-TYKCYLHXSA-N |
| XLogP | 3.65 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|