C19H27N3O2S — CID 146187132
1-[4-[(4R,5R)-4-hydroxy-2-phenyl-1-thia-2,7-diazaspiro[4.4]nonan-7-yl]piperidin-1-yl]ethanone (PubChem CID 146187132) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-[4-[(4R,5R)-4-hydroxy-2-phenyl-1-thia-2,7-diazaspiro[4.4]nonan-7-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(4R,5R)-4-hydroxy-2-phenyl-1-thia-2,7-diazaspiro[4.4]nonan-7-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 146187132 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-[4-[(4R,5R)-4-hydroxy-2-phenyl-1-thia-2,7-diazaspiro[4.4]nonan-7-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(N2CC[C@]3(C2)SN(c2ccccc2)C[C@H]3O)CC1 |
| InChI | InChI=1S/C19H27N3O2S/c1-15(23)20-10-7-16(8-11-20)21-12-9-19(14-21)18(24)13-22(25-19)17-5-3-2-4-6-17/h2-6,16,18,24H,7-14H2,1H3/t18-,19-/m1/s1 |
| InChIKey | ZQUMTCFXZYAFCH-RTBURBONSA-N |
| XLogP | 1.97 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|