C28H43N3O — CID 142638311
1-(1'-cyclodecyl-5-phenylspiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl)ethanone (PubChem CID 142638311) has the molecular formula C28H43N3O and a molecular weight of 437.67 g/mol. Its IUPAC name is 1-(1'-cyclodecyl-5-phenylspiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl)ethanone.
| Compound Name | 1-(1'-cyclodecyl-5-phenylspiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl)ethanone |
|---|---|
| PubChem CID | 142638311 |
| Molecular Formula | C28H43N3O |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.34 |
| IUPAC Name | 1-(1'-cyclodecyl-5-phenylspiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl)ethanone |
| SMILES | CC(=O)N1CC2CN(c3ccccc3)C3(CCN(C4CCCCCCCCC4)CC3)C2C1 |
| InChI | InChI=1S/C28H43N3O/c1-23(32)30-20-24-21-31(26-14-10-7-11-15-26)28(27(24)22-30)16-18-29(19-17-28)25-12-8-5-3-2-4-6-9-13-25/h7,10-11,14-15,24-25,27H,2-6,8-9,12-13,16-22H2,1H3 |
| InChIKey | QLXVPBBDXPCEEE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |