C27H40N2O4 — CID 23298924
(E)-but-2-enedioic acid;7-cyclodecyl-1-phenyl-1,7-diazaspiro[3.5]nonane (PubChem CID 23298924) has the molecular formula C27H40N2O4 and a molecular weight of 456.63 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;7-cyclodecyl-1-phenyl-1,7-diazaspiro[3.5]nonane.
| Compound Name | (E)-but-2-enedioic acid;7-cyclodecyl-1-phenyl-1,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 23298924 |
| Molecular Formula | C27H40N2O4 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | (E)-but-2-enedioic acid;7-cyclodecyl-1-phenyl-1,7-diazaspiro[3.5]nonane |
| SMILES | O=C(O)/C=C/C(=O)O.c1ccc(N2CCC23CCN(C2CCCCCCCCC2)CC3)cc1 |
| InChI | InChI=1S/C23H36N2.C4H4O4/c1-2-4-7-11-21(12-8-5-3-1)24-18-15-23(16-19-24)17-20-25(23)22-13-9-6-10-14-22;5-3(6)1-2-4(7)8/h6,9-10,13-14,21H,1-5,7-8,11-12,15-20H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | WAJRIRLMKNTYPI-WLHGVMLRSA-N |
| XLogP | 5.34 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|