C27H38N2O5 — CID 18002539
(E)-but-2-enedioic acid;8-cyclononyl-1-phenyl-1,8-diazaspiro[4.5]decan-4-one (PubChem CID 18002539) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;8-cyclononyl-1-phenyl-1,8-diazaspiro[4.5]decan-4-one.
| Compound Name | (E)-but-2-enedioic acid;8-cyclononyl-1-phenyl-1,8-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 18002539 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | (E)-but-2-enedioic acid;8-cyclononyl-1-phenyl-1,8-diazaspiro[4.5]decan-4-one |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1CCN(c2ccccc2)C12CCN(C1CCCCCCCC1)CC2 |
| InChI | InChI=1S/C23H34N2O.C4H4O4/c26-22-14-17-25(21-12-8-5-9-13-21)23(22)15-18-24(19-16-23)20-10-6-3-1-2-4-7-11-20;5-3(6)1-2-4(7)8/h5,8-9,12-13,20H,1-4,6-7,10-11,14-19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FUJWCWUDMMWEEX-WLHGVMLRSA-N |
| XLogP | 4.52 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|