C28H38N2O5 — CID 21268360
8-(1,2,3,3a,4,5,6,7,8,8a-decahydroazulen-2-yl)-1-phenyl-1,8-diazaspiro[4.5]decan-4-one;(E)-but-2-enedioic acid (PubChem CID 21268360) has the molecular formula C28H38N2O5 and a molecular weight of 482.62 g/mol. Its IUPAC name is 8-(1,2,3,3a,4,5,6,7,8,8a-decahydroazulen-2-yl)-1-phenyl-1,8-diazaspiro[4.5]decan-4-one;(E)-but-2-enedioic acid.
| Compound Name | 8-(1,2,3,3a,4,5,6,7,8,8a-decahydroazulen-2-yl)-1-phenyl-1,8-diazaspiro[4.5]decan-4-one;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 21268360 |
| Molecular Formula | C28H38N2O5 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 8-(1,2,3,3a,4,5,6,7,8,8a-decahydroazulen-2-yl)-1-phenyl-1,8-diazaspiro[4.5]decan-4-one;(E)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1CCN(c2ccccc2)C12CCN(C1CC3CCCCCC3C1)CC2 |
| InChI | InChI=1S/C24H34N2O.C4H4O4/c27-23-11-14-26(21-9-5-2-6-10-21)24(23)12-15-25(16-13-24)22-17-19-7-3-1-4-8-20(19)18-22;5-3(6)1-2-4(7)8/h2,5-6,9-10,19-20,22H,1,3-4,7-8,11-18H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | AYROAHIZRNLZRD-WLHGVMLRSA-N |
| XLogP | 4.37 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|