C25H36N2O4 — CID 146188382
(4R,7R,9E,11S,12S)-4,7-dihydroxy-7,11-dimethyl-12-[(2E,4E)-6-(4-methylpyrimidin-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one (PubChem CID 146188382) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is (4R,7R,9E,11S,12S)-4,7-dihydroxy-7,11-dimethyl-12-[(2E,4E)-6-(4-methylpyrimidin-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one.
| Compound Name | (4R,7R,9E,11S,12S)-4,7-dihydroxy-7,11-dimethyl-12-[(2E,4E)-6-(4-methylpyrimidin-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 146188382 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | (4R,7R,9E,11S,12S)-4,7-dihydroxy-7,11-dimethyl-12-[(2E,4E)-6-(4-methylpyrimidin-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
| SMILES | C/C(=C\C=C\C(C)c1nccc(C)n1)[C@H]1OC(=O)C[C@H](O)CC[C@@](C)(O)C/C=C/[C@@H]1C |
| InChI | InChI=1S/C25H36N2O4/c1-17(8-6-9-19(3)24-26-15-12-20(4)27-24)23-18(2)10-7-13-25(5,30)14-11-21(28)16-22(29)31-23/h6-10,12,15,18-19,21,23,28,30H,11,13-14,16H2,1-5H3/b9-6+,10-7+,17-8+/t18-,19?,21+,23+,25-/m0/s1 |
| InChIKey | DBGRIFGLMUVYGY-GPAMXXPUSA-N |
| XLogP | 4.18 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|