C11H9N3O3S — CID 146192622
(3S)-3-(2-methyl-4-oxothieno[3,2-d]pyrimidin-3-yl)pyrrolidine-2,5-dione (PubChem CID 146192622) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is (3S)-3-(2-methyl-4-oxothieno[3,2-d]pyrimidin-3-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(2-methyl-4-oxothieno[3,2-d]pyrimidin-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 146192622 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | (3S)-3-(2-methyl-4-oxothieno[3,2-d]pyrimidin-3-yl)pyrrolidine-2,5-dione |
| SMILES | Cc1nc2ccsc2c(=O)n1[C@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C11H9N3O3S/c1-5-12-6-2-3-18-9(6)11(17)14(5)7-4-8(15)13-10(7)16/h2-3,7H,4H2,1H3,(H,13,15,16)/t7-/m0/s1 |
| InChIKey | VOADSBSPJRDUFY-ZETCQYMHSA-N |
| XLogP | 0.35 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|