C11H10O6 — CID 146197616
2-(5,7-dihydroxy-2-oxo-3,4-dihydrochromen-3-yl)acetic acid (PubChem CID 146197616) has the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. Its IUPAC name is 2-(5,7-dihydroxy-2-oxo-3,4-dihydrochromen-3-yl)acetic acid.
| Compound Name | 2-(5,7-dihydroxy-2-oxo-3,4-dihydrochromen-3-yl)acetic acid |
|---|---|
| PubChem CID | 146197616 |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-(5,7-dihydroxy-2-oxo-3,4-dihydrochromen-3-yl)acetic acid |
| SMILES | O=C(O)CC1Cc2c(O)cc(O)cc2OC1=O |
| InChI | InChI=1S/C11H10O6/c12-6-3-8(13)7-1-5(2-10(14)15)11(16)17-9(7)4-6/h3-5,12-13H,1-2H2,(H,14,15) |
| InChIKey | OOFUYIKQLZTLMH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|