C15H12O7 — CID 91070591
5-[(3R)-3,5,7-trihydroxy-3,4-dihydrochromen-2-ylidene]cyclohexane-1,2,3-trione (PubChem CID 91070591) has the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. Its IUPAC name is 5-[(3R)-3,5,7-trihydroxy-3,4-dihydrochromen-2-ylidene]cyclohexane-1,2,3-trione.
| Compound Name | 5-[(3R)-3,5,7-trihydroxy-3,4-dihydrochromen-2-ylidene]cyclohexane-1,2,3-trione |
|---|---|
| PubChem CID | 91070591 |
| Molecular Formula | C15H12O7 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 5-[(3R)-3,5,7-trihydroxy-3,4-dihydrochromen-2-ylidene]cyclohexane-1,2,3-trione |
| SMILES | O=C1CC(=C2Oc3cc(O)cc(O)c3C[C@H]2O)CC(=O)C1=O |
| InChI | InChI=1S/C15H12O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h3-4,12,16-17,20H,1-2,5H2/t12-/m1/s1 |
| InChIKey | MPLXRYXMGQIBAR-GFCCVEGCSA-N |
| XLogP | 0.15 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|