About 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol
7-(propylamino)-3,4-dihydro-2H-chromen-5-ol (PubChem CID 146197617) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol.
Molecular Properties
| Compound Name | 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol |
| PubChem CID | 146197617 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol |
| SMILES | CCCNc1cc(O)c2c(c1)OCCC2 |
| InChI | InChI=1S/C12H17NO2/c1-2-5-13-9-7-11(14)10-4-3-6-15-12(10)8-9/h7-8,13-14H,2-6H2,1H3 |
| InChIKey | ZOFJXNIJHJWIJU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol?
The IUPAC name of 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol (CID 146197617) is 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol.
What is the SMILES notation for 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol?
The canonical SMILES for 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol is CCCNc1cc(O)c2c(c1)OCCC2.
What is the InChIKey of 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol?
The InChIKey is ZOFJXNIJHJWIJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-2-5-13-9-7-11(14)10-4-3-6-15-12(10)8-9/h7-8,13-14H,2-6H2,1H3.
What are the key properties of 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol?
7-(propylamino)-3,4-dihydro-2H-chromen-5-ol has a molecular weight of 207.27 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(propylamino)-3,4-dihydro-2H-chromen-5-ol is sourced from PubChem (CID 146197617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).