C48H33N5 — CID 146199261
8-[3-[4,6-bis(3-phenylphenyl)-4,5-dihydropyrimidin-2-yl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene (PubChem CID 146199261) has the molecular formula C48H33N5 and a molecular weight of 679.83 g/mol. Its IUPAC name is 8-[3-[4,6-bis(3-phenylphenyl)-4,5-dihydropyrimidin-2-yl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene.
| Compound Name | 8-[3-[4,6-bis(3-phenylphenyl)-4,5-dihydropyrimidin-2-yl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
|---|---|
| PubChem CID | 146199261 |
| Molecular Formula | C48H33N5 |
| Molecular Weight | 679.83 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | 8-[3-[4,6-bis(3-phenylphenyl)-4,5-dihydropyrimidin-2-yl]phenyl]-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| SMILES | c1ccc(-c2cccc(C3=NC(c4cccc(-c5nc6c(nc7ccccn76)c6ccccc56)c4)=NC(c4cccc(-c5ccccc5)c4)C3)c2)cc1 |
| InChI | InChI=1S/C48H33N5/c1-3-14-32(15-4-1)34-18-11-20-36(28-34)42-31-43(37-21-12-19-35(29-37)33-16-5-2-6-17-33)50-47(49-42)39-23-13-22-38(30-39)45-40-24-7-8-25-41(40)46-48(52-45)53-27-10-9-26-44(53)51-46/h1-30,42H,31H2 |
| InChIKey | WKPVWDWPZNYFGS-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 54.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.83 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |