C12H17ClN2O3S — CID 146200931
tert-butyl N-[(6-chloro-4-methylsulfanyl-2-oxo-1H-pyridin-3-yl)methyl]carbamate (PubChem CID 146200931) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is tert-butyl N-[(6-chloro-4-methylsulfanyl-2-oxo-1H-pyridin-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-chloro-4-methylsulfanyl-2-oxo-1H-pyridin-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 146200931 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | tert-butyl N-[(6-chloro-4-methylsulfanyl-2-oxo-1H-pyridin-3-yl)methyl]carbamate |
| SMILES | CSc1cc(Cl)[nH]c(=O)c1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H17ClN2O3S/c1-12(2,3)18-11(17)14-6-7-8(19-4)5-9(13)15-10(7)16/h5H,6H2,1-4H3,(H,14,17)(H,15,16) |
| InChIKey | LOZAUUYAHZFRJQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|