C10H14ClN3O3 — CID 169128766
tert-butyl N-[(5-chloro-6-oxo-1H-pyridazin-4-yl)methyl]carbamate (PubChem CID 169128766) has the molecular formula C10H14ClN3O3 and a molecular weight of 259.69 g/mol. Its IUPAC name is tert-butyl N-[(5-chloro-6-oxo-1H-pyridazin-4-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(5-chloro-6-oxo-1H-pyridazin-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 169128766 |
| Molecular Formula | C10H14ClN3O3 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | tert-butyl N-[(5-chloro-6-oxo-1H-pyridazin-4-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cn[nH]c(=O)c1Cl |
| InChI | InChI=1S/C10H14ClN3O3/c1-10(2,3)17-9(16)12-4-6-5-13-14-8(15)7(6)11/h5H,4H2,1-3H3,(H,12,16)(H,14,15) |
| InChIKey | BDVPBGSJTNHHFR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |