C12H18N4O4 — CID 146203963
(2S)-2-[[2-[(2,5-dioxopyrrol-1-yl)amino]acetyl]-methylamino]-3-methylbutanamide (PubChem CID 146203963) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2S)-2-[[2-[(2,5-dioxopyrrol-1-yl)amino]acetyl]-methylamino]-3-methylbutanamide.
| Compound Name | (2S)-2-[[2-[(2,5-dioxopyrrol-1-yl)amino]acetyl]-methylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 146203963 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (2S)-2-[[2-[(2,5-dioxopyrrol-1-yl)amino]acetyl]-methylamino]-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(N)=O)N(C)C(=O)CNN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H18N4O4/c1-7(2)11(12(13)20)15(3)10(19)6-14-16-8(17)4-5-9(16)18/h4-5,7,11,14H,6H2,1-3H3,(H2,13,20)/t11-/m0/s1 |
| InChIKey | BGBPDJHXFOZQNF-NSHDSACASA-N |
| XLogP | -1.62 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|