C10H15N3O3 — CID 134511159
(2S)-2-[(2,5-dioxopyrrol-1-yl)amino]-N,3-dimethylbutanamide (PubChem CID 134511159) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is (2S)-2-[(2,5-dioxopyrrol-1-yl)amino]-N,3-dimethylbutanamide.
| Compound Name | (2S)-2-[(2,5-dioxopyrrol-1-yl)amino]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 134511159 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (2S)-2-[(2,5-dioxopyrrol-1-yl)amino]-N,3-dimethylbutanamide |
| SMILES | CNC(=O)[C@@H](NN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C10H15N3O3/c1-6(2)9(10(16)11-3)12-13-7(14)4-5-8(13)15/h4-6,9,12H,1-3H3,(H,11,16)/t9-/m0/s1 |
| InChIKey | ZJGDYUDYNCXNJR-VIFPVBQESA-N |
| XLogP | -0.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|