C20H30N2O3 — CID 146204294
tert-butyl N-[5-methyl-6-(4-methylanilino)-4-methylidene-6-oxohexan-2-yl]carbamate (PubChem CID 146204294) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is tert-butyl N-[5-methyl-6-(4-methylanilino)-4-methylidene-6-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-methyl-6-(4-methylanilino)-4-methylidene-6-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 146204294 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl N-[5-methyl-6-(4-methylanilino)-4-methylidene-6-oxohexan-2-yl]carbamate |
| SMILES | C=C(CC(C)NC(=O)OC(C)(C)C)C(C)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H30N2O3/c1-13-8-10-17(11-9-13)22-18(23)16(4)14(2)12-15(3)21-19(24)25-20(5,6)7/h8-11,15-16H,2,12H2,1,3-7H3,(H,21,24)(H,22,23) |
| InChIKey | AJHWJCKOMPZFTC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|