C8H13N3 — CID 146207795
8-methyl-3,4,5,6,7,8-hexahydropyrrolo[3,2-e][1,4]diazepine (PubChem CID 146207795) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 8-methyl-3,4,5,6,7,8-hexahydropyrrolo[3,2-e][1,4]diazepine.
| Compound Name | 8-methyl-3,4,5,6,7,8-hexahydropyrrolo[3,2-e][1,4]diazepine |
|---|---|
| PubChem CID | 146207795 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 8-methyl-3,4,5,6,7,8-hexahydropyrrolo[3,2-e][1,4]diazepine |
| SMILES | CC1CNC2=C1N=CCNC2 |
| InChI | InChI=1S/C8H13N3/c1-6-4-11-7-5-9-2-3-10-8(6)7/h3,6,9,11H,2,4-5H2,1H3 |
| InChIKey | QVIXUOLPCZYCIA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |