About N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide
N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide (PubChem CID 146212145) has the molecular formula C21H34N4O7
and a molecular weight of 454.52 g/mol. Its IUPAC name is N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide.
Molecular Properties
| Compound Name | N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide |
| PubChem CID | 146212145 |
| Molecular Formula | C21H34N4O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide |
| SMILES | CCC(CN(C(C)=O)C(C)=O)N(C(C)=O)C(=O)CCC(=O)N(CC(C)NC(C)=O)C(C)=O |
| InChI | InChI=1S/C21H34N4O7/c1-8-19(12-23(15(4)27)16(5)28)25(18(7)30)21(32)10-9-20(31)24(17(6)29)11-13(2)22-14(3)26/h13,19H,8-12H2,1-7H3,(H,22,26) |
| InChIKey | FGKFOPLERILKHY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 141.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide?
The IUPAC name of N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide (CID 146212145) is N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide.
What is the SMILES notation for N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide?
The canonical SMILES for N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide is CCC(CN(C(C)=O)C(C)=O)N(C(C)=O)C(=O)CCC(=O)N(CC(C)NC(C)=O)C(C)=O.
What is the InChIKey of N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide?
The InChIKey is FGKFOPLERILKHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N4O7/c1-8-19(12-23(15(4)27)16(5)28)25(18(7)30)21(32)10-9-20(31)24(17(6)29)11-13(2)22-14(3)26/h13,19H,8-12H2,1-7H3,(H,22,26).
What are the key properties of N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide?
N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide has a molecular weight of 454.52 g/mol, XLogP of 0.22, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-acetamidopropyl)-N,N'-diacetyl-N'-[1-(diacetylamino)butan-2-yl]butanediamide is sourced from PubChem (CID 146212145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).