C14H23NO2 — CID 146231971
(2E,4Z,6Z)-N-(2-methoxyethyl)-N-(oxiran-2-ylmethyl)octa-2,4,6-trien-3-amine (PubChem CID 146231971) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (2E,4Z,6Z)-N-(2-methoxyethyl)-N-(oxiran-2-ylmethyl)octa-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z,6Z)-N-(2-methoxyethyl)-N-(oxiran-2-ylmethyl)octa-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 146231971 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (2E,4Z,6Z)-N-(2-methoxyethyl)-N-(oxiran-2-ylmethyl)octa-2,4,6-trien-3-amine |
| SMILES | C/C=C\C=C/C(=C\C)N(CCOC)CC1CO1 |
| InChI | InChI=1S/C14H23NO2/c1-4-6-7-8-13(5-2)15(9-10-16-3)11-14-12-17-14/h4-8,14H,9-12H2,1-3H3/b6-4-,8-7-,13-5+ |
| InChIKey | AHZZVAMZYGFLLO-WFRMCWMISA-N |
| XLogP | 2.37 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|