C19H22N2O4 — CID 146236579
[3-[1-[5-(4-methoxyphenyl)-2-pyridinyl]ethoxy]cyclobutyl] carbamate (PubChem CID 146236579) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is [3-[1-[5-(4-methoxyphenyl)-2-pyridinyl]ethoxy]cyclobutyl] carbamate.
| Compound Name | [3-[1-[5-(4-methoxyphenyl)-2-pyridinyl]ethoxy]cyclobutyl] carbamate |
|---|---|
| PubChem CID | 146236579 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [3-[1-[5-(4-methoxyphenyl)-2-pyridinyl]ethoxy]cyclobutyl] carbamate |
| SMILES | COc1ccc(-c2ccc(C(C)OC3CC(OC(N)=O)C3)nc2)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-12(24-16-9-17(10-16)25-19(20)22)18-8-5-14(11-21-18)13-3-6-15(23-2)7-4-13/h3-8,11-12,16-17H,9-10H2,1-2H3,(H2,20,22) |
| InChIKey | ANGUVHIHUXFBEB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |