C12H26N2 — CID 146238054
1-N-ethyl-1-N'-[(E)-3-ethylhex-1-enyl]ethane-1,1-diamine (PubChem CID 146238054) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 1-N-ethyl-1-N'-[(E)-3-ethylhex-1-enyl]ethane-1,1-diamine.
| Compound Name | 1-N-ethyl-1-N'-[(E)-3-ethylhex-1-enyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 146238054 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 1-N-ethyl-1-N'-[(E)-3-ethylhex-1-enyl]ethane-1,1-diamine |
| SMILES | CCCC(/C=C/NC(C)NCC)CC |
| InChI | InChI=1S/C12H26N2/c1-5-8-12(6-2)9-10-14-11(4)13-7-3/h9-14H,5-8H2,1-4H3/b10-9+ |
| InChIKey | VWQIQHMCTWYXMV-MDZDMXLPSA-N |
| XLogP | 2.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|