C29H25N3O3 — CID 146239185
3-ethanimidoyl-2-[(4-phenoxyphenyl)methylamino]-6-[(E)-2-phenylethenyl]pyridine-4-carboxylic acid (PubChem CID 146239185) has the molecular formula C29H25N3O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is 3-ethanimidoyl-2-[(4-phenoxyphenyl)methylamino]-6-[(E)-2-phenylethenyl]pyridine-4-carboxylic acid.
| Compound Name | 3-ethanimidoyl-2-[(4-phenoxyphenyl)methylamino]-6-[(E)-2-phenylethenyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 146239185 |
| Molecular Formula | C29H25N3O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 3-ethanimidoyl-2-[(4-phenoxyphenyl)methylamino]-6-[(E)-2-phenylethenyl]pyridine-4-carboxylic acid |
| SMILES | [H]/N=C(\C)c1c(C(=O)O)cc(/C=C/c2ccccc2)nc1NCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H25N3O3/c1-20(30)27-26(29(33)34)18-23(15-12-21-8-4-2-5-9-21)32-28(27)31-19-22-13-16-25(17-14-22)35-24-10-6-3-7-11-24/h2-18,30H,19H2,1H3,(H,31,32)(H,33,34)/b15-12+,30-20+ |
| InChIKey | ATWGVTCVPPQTSY-BKTAQPOTSA-N |
| XLogP | 6.74 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|