C31H31N3O3 — CID 146239225
ethyl 3-ethanimidoyl-2-[(4-phenoxyphenyl)methylamino]-6-(2-phenylethyl)pyridine-4-carboxylate (PubChem CID 146239225) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is ethyl 3-ethanimidoyl-2-[(4-phenoxyphenyl)methylamino]-6-(2-phenylethyl)pyridine-4-carboxylate.
| Compound Name | ethyl 3-ethanimidoyl-2-[(4-phenoxyphenyl)methylamino]-6-(2-phenylethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 146239225 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | ethyl 3-ethanimidoyl-2-[(4-phenoxyphenyl)methylamino]-6-(2-phenylethyl)pyridine-4-carboxylate |
| SMILES | [H]/N=C(\C)c1c(C(=O)OCC)cc(CCc2ccccc2)nc1NCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C31H31N3O3/c1-3-36-31(35)28-20-25(17-14-23-10-6-4-7-11-23)34-30(29(28)22(2)32)33-21-24-15-18-27(19-16-24)37-26-12-8-5-9-13-26/h4-13,15-16,18-20,32H,3,14,17,21H2,1-2H3,(H,33,34)/b32-22+ |
| InChIKey | IRTXKGOIXZOSLE-WEMUVCOSSA-N |
| XLogP | 6.84 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|