C19H19N3O2S — CID 146241143
3-methyl-8-oxido-4-(3-phenylmethoxypropyl)-12-thia-3,5-diaza-8-azoniatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene (PubChem CID 146241143) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 3-methyl-8-oxido-4-(3-phenylmethoxypropyl)-12-thia-3,5-diaza-8-azoniatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene.
| Compound Name | 3-methyl-8-oxido-4-(3-phenylmethoxypropyl)-12-thia-3,5-diaza-8-azoniatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 146241143 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3-methyl-8-oxido-4-(3-phenylmethoxypropyl)-12-thia-3,5-diaza-8-azoniatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
| SMILES | Cn1c(CCCOCc2ccccc2)nc2c[n+]([O-])c3ccsc3c21 |
| InChI | InChI=1S/C19H19N3O2S/c1-21-17(8-5-10-24-13-14-6-3-2-4-7-14)20-15-12-22(23)16-9-11-25-19(16)18(15)21/h2-4,6-7,9,11-12H,5,8,10,13H2,1H3 |
| InChIKey | KHRHBRVIRIAHGP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|